| Compound Information | SONAR Target prediction | | Name: | Ethaverine hydrochloride | | Unique Identifier: | Prest1049 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24ClH30NO4 | | Molecular Weight: | 401.714 g/mol | | X log p: | 15.994 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.28 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
5266.0000±0 |
| Normalized OD Score: sc h |
0.9713±0 |
| Z-Score: |
-0.6462±0 |
| p-Value: |
0.51817 |
| Z-Factor: |
-11.2006 |
| Fitness Defect: |
0.6575 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 11|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.20 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 853.5±701.09504 | | Plate DMSO Control (-): | 849±311.18603 | | Plate Z-Factor: | -72.3031 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
| 5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|
