Compound Information | SONAR Target prediction | Name: | Propidium iodide | Unique Identifier: | Prest1017 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C27H36I2N4 | Molecular Weight: | 634.125 g/mol | X log p: | 22.536 (online calculus) | Lipinksi Failures | 1 | TPSA | 3.01 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | [IH-].[IH-].CC[N+](C)(CC)CCC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | Generic_name: | PROPIDIUM | Chemical_iupac_name: | 3,8-DIAMINO-5[3-(DIETHYLMETHYLAMMONIO)PROPYL]-6-PHENYLPHENANTHRIDINIUM | Drug_type: | Experimental | Drugbank_id: | EXPT02661 | Drug_category: | Acetylcholinesterase inhibitor | Organisms_affected: | -1 |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
1924.0000±0 |
Normalized OD Score: sc h |
0.1421±0 |
Z-Score: |
-23.8657±0 |
p-Value: |
0 |
Z-Factor: |
-0.537101 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 10|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.30 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 22161±7450.25778 | Plate DMSO Control (-): | 13194±7524.46004 | Plate Z-Factor: | -6.8985 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4939 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium |
104981 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium diiodide |
153045 |
5-(3-diethylaminopropyl)-6-phenyl-phenanthridine-3,8-diamine |
16043037 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium dibromide |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 | |
|