| 
 | Compound Information | SONAR Target prediction |  | Name: | Propidium iodide |  | Unique Identifier: | Prest1017 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C27H36I2N4 |  | Molecular Weight: | 634.125 g/mol |  | X log p: | 22.536  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 3.01 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | [IH-].[IH-].CC[N+](C)(CC)CCC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 |  | Generic_name: | PROPIDIUM |  | Chemical_iupac_name: | 3,8-DIAMINO-5[3-(DIETHYLMETHYLAMMONIO)PROPYL]-6-PHENYLPHENANTHRIDINIUM |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT02661 |  | Drug_category: | Acetylcholinesterase inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 9606 |  
		| Condition: | TMPPre002 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 1112.5000±0 |  
		| Normalized OD Score: sc h | 0.2593±0 |  
		| Z-Score: | -16.6950±0 |  
		| p-Value: | 0 |  
		| Z-Factor: | -0.252547 |  
		| Fitness Defect: | INF |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 10|H3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.30 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 870.5±769.75857 |  | Plate DMSO Control (-): | 982.5±305.13061 |  | Plate Z-Factor: | -45.8313 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 4 |  | 
 
	
		| 4939 | 3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium |  
		| 104981 | 3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium diiodide |  
		| 153045 | 5-(3-diethylaminopropyl)-6-phenyl-phenanthridine-3,8-diamine |  
		| 16043037 | 3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium dibromide |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 |  | 
 
 |