| Compound Information | SONAR Target prediction | | Name: | Propidium iodide | | Unique Identifier: | Prest1017 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H36I2N4 | | Molecular Weight: | 634.125 g/mol | | X log p: | 22.536 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 3.01 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | [IH-].[IH-].CC[N+](C)(CC)CCC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | | Generic_name: | PROPIDIUM | | Chemical_iupac_name: | 3,8-DIAMINO-5[3-(DIETHYLMETHYLAMMONIO)PROPYL]-6-PHENYLPHENANTHRIDINIUM | | Drug_type: | Experimental | | Drugbank_id: | EXPT02661 | | Drug_category: | Acetylcholinesterase inhibitor | | Organisms_affected: | -1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
301.0000±0 |
| Normalized OD Score: sc h |
0.2593±0 |
| Z-Score: |
-16.6950±0 |
| p-Value: |
0 |
| Z-Factor: |
-0.252547 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 10|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 870.5±769.75857 | | Plate DMSO Control (-): | 982.5±305.13061 | | Plate Z-Factor: | -45.8313 |
| png ps pdf |
| DBLink | Rows returned: 4 | |
| 4939 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium |
| 104981 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium diiodide |
| 153045 |
5-(3-diethylaminopropyl)-6-phenyl-phenanthridine-3,8-diamine |
| 16043037 |
3-(3,8-diamino-6-phenyl-phenanthridin-5-yl)propyl-diethyl-methyl-azanium dibromide |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 6881 | Additional Members: 3 | Rows returned: 2 | |
|