Compound Information | SONAR Target prediction | Name: | Methotrimeprazine maleat salt | Unique Identifier: | Prest1008 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C23H28N2O5S | Molecular Weight: | 416.323 g/mol | X log p: | 16.31 (online calculus) | Lipinksi Failures | 1 | TPSA | 41.01 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1ccc2Sc3ccccc3N(CC(C)CN(C)C)c2c1.OC(=O)C=CC(O)=O |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
5617.0000±0 |
Normalized OD Score: sc h |
0.7200±0 |
Z-Score: |
-6.3111±0 |
p-Value: |
0.00000000027703 |
Z-Factor: |
-2.29039 |
Fitness Defect: |
22.0069 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 10|H8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.30 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 870.5±769.75857 | Plate DMSO Control (-): | 982.5±305.13061 | Plate Z-Factor: | -45.8313 |
| png ps pdf |
DBLink | Rows returned: 6 | |
18846 |
but-2-enedioic acid; 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethyl-propan-1-amine |
72286 |
but-2-enedioic acid; (2R)-3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethyl-propan-1-amine |
5282484 |
but-2-enedioic acid; (2R)-3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethyl-propan-1-amine |
6420056 |
but-2-enedioic acid; 3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethyl-propan-1-amine |
6433365 |
but-2-enedioic acid; 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethyl-propan-1-amine |
6506696 |
but-2-enedioic acid; 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethyl-propan-1-amine |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 15250 | Additional Members: 5 | Rows returned: 2 | |
|