Compound Information | SONAR Target prediction | Name: | N-arachidonylglycine | Unique Identifier: | LOPAC 01302 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22H35NO3 | Molecular Weight: | 326.24 g/mol | X log p: | 15.405 (online calculus) | Lipinksi Failures | 2 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 17 | Canonical Smiles: | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCC(O)=O | Class: | Cannabinoid | Action: | Inhibitor | Selectivity: | FAAH |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.7900±0.00417193 |
Normalized OD Score: sc h |
0.9845±0.0113401 |
Z-Score: |
-0.7063±0.524628 |
p-Value: |
0.509376 |
Z-Factor: |
-12.6002 |
Fitness Defect: |
0.6746 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|H5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2005-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.04345±0.00828 | Plate DMSO Control (-): | 0.75095±0.02945 | Plate Z-Factor: | 0.9179 |
| png ps pdf |
DBLink | Rows returned: 2 | |
4345 |
2-(icosa-5,8,11,14-tetraenoylamino)acetic acid |
5283389 |
2-[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]amino]acetic acid |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 8909 | Additional Members: 3 | Rows returned: 1 | |
|