| Compound Information | SONAR Target prediction | | Name: | N-arachidonylglycine | | Unique Identifier: | LOPAC 01302 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22H35NO3 | | Molecular Weight: | 326.24 g/mol | | X log p: | 15.405 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 17 | | Canonical Smiles: | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCC(O)=O | | Class: | Cannabinoid | | Action: | Inhibitor | | Selectivity: | FAAH |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7642±0.0841978 |
| Normalized OD Score: sc h |
0.9884±0.0441785 |
| Z-Score: |
-0.6169±1.20514 |
| p-Value: |
0.386636 |
| Z-Factor: |
-27.9687 |
| Fitness Defect: |
0.9503 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 1|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04716875000000002±0.00193 | | Plate DMSO Control (-): | 0.7670249999999997±0.04497 | | Plate Z-Factor: | 0.7866 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 4345 |
2-(icosa-5,8,11,14-tetraenoylamino)acetic acid |
| 5283389 |
2-[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]amino]acetic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 8909 | Additional Members: 3 | Rows returned: 1 | |
|
