| Compound Information | SONAR Target prediction | | Name: | Uridine 5`-diphosphate sodium | | Unique Identifier: | LOPAC 01281 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C9H12N2Na2O12P2 | | Molecular Weight: | 436.03 g/mol | | X log p: | 0.0509999999999993 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 164.95 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 14 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | [Na+].[Na+].[O-]P(O)(=O)OP([O-])(=O)OCC1OC(C(O)C1O)N1C=CC(=O)NC1=O | | Class: | P2 Receptor | | Action: | Agonist | | Selectivity: | P2Y | | Generic_name: | URIDINE-5--DIPHOSPHATE | | Chemical_iupac_name: | URIDINE-5--DIPHOSPHATE | | Drug_type: | Experimental | | Kegg_compound_id: | C00015 | | Drugbank_id: | EXPT03172 | | Logp: | -4.27 +/- 0.71 | | Cas_registry_number: | 58-98-0 | | Drug_category: | N-Acetyllactosaminide Alpha-1,3- Galactosylt inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
WHI3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7150±0.0459619 |
| Normalized OD Score: sc h |
0.9666±0.0216042 |
| Z-Score: |
-1.1918±0.498689 |
| p-Value: |
0.261944 |
| Z-Factor: |
-3.86283 |
| Fitness Defect: |
1.3396 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 16|A6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.043475±0.00338 | | Plate DMSO Control (-): | 0.68225±0.02729 | | Plate Z-Factor: | 0.8258 |
| png ps pdf |
| 1158 |
[[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid |
| 6031 |
[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphos phonic acid |
| 88264 |
trisodium 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-[(oxido-phosphonatooxy-phosphoryl)oxymethyl]oxolan-2-yl]pyrimidine-2,4- dione |
| 3084485 |
disodium [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-phosphonatooxy-phosphinic acid |
| 3084486 |
[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid |
| 4994354 |
[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-phosphonatooxy-phosphinic acid |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 7710 | Additional Members: 3 | Rows returned: 2 | |
|