Compound Information | SONAR Target prediction | Name: | Uridine 5`-diphosphate sodium | Unique Identifier: | LOPAC 01281 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C9H12N2Na2O12P2 | Molecular Weight: | 436.03 g/mol | X log p: | 0.0509999999999993 (online calculus) | Lipinksi Failures | 1 | TPSA | 164.95 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 14 | Rotatable Bond Count: | 6 | Canonical Smiles: | [Na+].[Na+].[O-]P(O)(=O)OP([O-])(=O)OCC1OC(C(O)C1O)N1C=CC(=O)NC1=O | Class: | P2 Receptor | Action: | Agonist | Selectivity: | P2Y | Generic_name: | URIDINE-5--DIPHOSPHATE | Chemical_iupac_name: | URIDINE-5--DIPHOSPHATE | Drug_type: | Experimental | Kegg_compound_id: | C00015 | Drugbank_id: | EXPT03172 | Logp: | -4.27 +/- 0.71 | Cas_registry_number: | 58-98-0 | Drug_category: | N-Acetyllactosaminide Alpha-1,3- Galactosylt inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
GIM3 |
Replicates: |
4 |
Raw OD Value: r im |
0.5492±0.160974 |
Normalized OD Score: sc h |
0.9826±0.0439289 |
Z-Score: |
-0.1486±0.836409 |
p-Value: |
0.481224 |
Z-Factor: |
-5.53511 |
Fitness Defect: |
0.7314 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 16|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.70 Celcius | Date: | 2005-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.0463±0.00190 | Plate DMSO Control (-): | 0.6698625000000001±0.13841 | Plate Z-Factor: | 0.0496 |
| png ps pdf |
6604174 |
disodium 1-[(2R,3S,4S,5S)-3,4-dihydroxy-5-[[(hydroxy-oxido-phosphoryl)oxy-oxido-phosphoryl]oxymethyl]oxolan-2-yl] pyrimidine-2,4-dione |
6604175 |
[[(2S,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphos phonic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 7710 | Additional Members: 3 | Rows returned: 0 | |
|