| Compound Information | SONAR Target prediction | | Name: | Uridine 5`-diphosphate sodium | | Unique Identifier: | LOPAC 01281 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C9H12N2Na2O12P2 | | Molecular Weight: | 436.03 g/mol | | X log p: | 0.0509999999999993 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 164.95 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 14 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | [Na+].[Na+].[O-]P(O)(=O)OP([O-])(=O)OCC1OC(C(O)C1O)N1C=CC(=O)NC1=O | | Class: | P2 Receptor | | Action: | Agonist | | Selectivity: | P2Y | | Generic_name: | URIDINE-5--DIPHOSPHATE | | Chemical_iupac_name: | URIDINE-5--DIPHOSPHATE | | Drug_type: | Experimental | | Kegg_compound_id: | C00015 | | Drugbank_id: | EXPT03172 | | Logp: | -4.27 +/- 0.71 | | Cas_registry_number: | 58-98-0 | | Drug_category: | N-Acetyllactosaminide Alpha-1,3- Galactosylt inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
MRC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8252±0.00410122 |
| Normalized OD Score: sc h |
0.9908±0.00260337 |
| Z-Score: |
-0.6786±0.253595 |
| p-Value: |
0.504246 |
| Z-Factor: |
-4.29975 |
| Fitness Defect: |
0.6847 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 16|A6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2005-12-06 YYYY-MM-DD | | Plate CH Control (+): | 0.040425±0.19140 | | Plate DMSO Control (-): | 0.808925±0.00891 | | Plate Z-Factor: | 0.9537 |
| png ps pdf |
| 6604174 |
disodium 1-[(2R,3S,4S,5S)-3,4-dihydroxy-5-[[(hydroxy-oxido-phosphoryl)oxy-oxido-phosphoryl]oxymethyl]oxolan-2-yl] pyrimidine-2,4-dione |
| 6604175 |
[[(2S,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphos phonic acid |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 7710 | Additional Members: 3 | Rows returned: 0 | |
|