| Compound Information | SONAR Target prediction |
| Name: | (±)-Thalidomide |
| Unique Identifier: | LOPAC 01279 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C13H10N2O4 |
| Molecular Weight: | 248.15 g/mol |
| X log p: | 6.737 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 71.52 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 |
| Class: | Cytoskeleton and ECM |
| Action: | Inhibitor |
| Selectivity: | TNFalpha |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | GIM3 |
| Replicates: | 4 |
| Raw OD Value: r im | 0.5783±0.136859 |
| Normalized OD Score: sc h | 1.0417±0.0313813 |
| Z-Score: | 0.8536±0.363231 |
| p-Value: | 0.395298 |
| Z-Factor: | -2.9129 |
| Fitness Defect: | 0.9281 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7702 | Additional Members: 4 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory