| Compound Information | SONAR Target prediction |
| Name: | Triflupromazine hydrochloride |
| Unique Identifier: | LOPAC 01241 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18ClF3H20N2S |
| Molecular Weight: | 368.72 g/mol |
| X log p: | 16.868 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 31.78 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | Cl.CN(C)CCCN1c2ccccc2Sc2ccc(cc12)C(F)(F)F |
| Class: | Dopamine |
| Action: | Antagonist |
| Selectivity: | DRD2 |
| Generic_name: | Triflupromazine |
| Chemical_iupac_name: | N,N-dimethyl-3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]-propan-1-amine |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451773 |
| Kegg_compound_id: | C07169 |
| Drugbank_id: | APRD00465 |
| Logp: | 5.888 |
| Cas_registry_number: | 146-54-3 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C146543&Index=0&Type=Mass&Large=on |
| Drug_category: | Antipsychotics; Antiemetics; ATC:N05AA05 |
| Indication: | Used mainly in the management of psychoses. Also used to control nausea and vomiting. |
| Pharmacology: | Triflupromazine is a member of a class of drugs called phenthiazines, which are dopamine D1/D2 receptor antagonists. Phenothiazines are used to treat serious mental and emotional disorders, including schizophrenia and other psychotic disorders. It reduces anxiety, emotional withdrawal, hallucinations, disorganized thoughts, blunted mood, and suspiciousness. Triflupromazine is used particularly to control violent behavior during acute episodes of psychotic disorders. It can also be used to control severe nausea and vomiting, severe hiccups, and moderate to severe pain in some hospitalized patients. Triflupromazine acts on the central nervous system. |
| Mechanism_of_action: | Triflupromazine binds to the dopamine D1 and dopamine D2 receptors and inhibits their activity. The mechanism of the anti-emetic effect is due predominantly to blockage of the dopamine D2 neurotransmitter receptors in the chemoreceptor trigger zone (CTZ) and vomiting centre. Triflupromazine blocks the neurotransmitter dopamine and the vagus nerve in the gastrointestinal tract. Triflupromazine also binds the muscarinic acetylcholine receptors (M1 and M2) and the tryptamine D receptors (5HT2B). |
| Organisms_affected: | Humans and other mammals |
| Found: 2 active | as graph: single | with analogs | 1 2 Next >> |
| Species: | 4932 |
| Condition: | MT2481-pdr1pdr3 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6856±0.00558614 |
| Normalized OD Score: sc h | 1.0736±0.000556954 |
| Z-Score: | 4.1516±0.312166 |
| p-Value: | 0.0000484578 |
| Z-Factor: | -0.0136631 |
| Fitness Defect: | 9.9348 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 4 |
| 5568 | N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
| 66069 | N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine hydrochloride |
| 72136 | N,N,2-trimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
| 657251 | N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine; hydrogen(+1) cation; chloride |
| internal high similarity DBLink | Rows returned: 3 |
| SPE01500591 | 0.9194 |
| LOPAC 00319 | 0.9256 |
| SPE01503118 | 1.0000 |
| active | Cluster 6041 | Additional Members: 22 | Rows returned: 15 | << Back 1 2 3 Next >> |
| SPE01503118 | 0.306451612903226 |
| Prest244 | 0.287878787878788 |
| SPE01500505 | 0.253968253968254 |
| LOPAC 00300 | 0.253968253968254 |
| LOPAC 00285 | 0.19672131147541 |
| SPE01500994 | 0.19672131147541 |
Service provided by the
Mike Tyers Laboratory