Compound Information | SONAR Target prediction | Name: | Terbutaline hemisulfate | Unique Identifier: | LOPAC 01240 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24H40N2O10S | Molecular Weight: | 508.33 g/mol | X log p: | 5.569 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)(C)NCC(O)c1cc(O)cc(O)c1.CC(C)(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O | Class: | Adrenoceptor | Action: | Agonist | Selectivity: | beta |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5950±0.020294 |
Normalized OD Score: sc h |
0.9716±0.00777451 |
Z-Score: |
-0.7866±0.274881 |
p-Value: |
0.440164 |
Z-Factor: |
-2.57756 |
Fitness Defect: |
0.8206 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 15|A7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.038775000000000004±0.00132 | Plate DMSO Control (-): | 0.610625±0.01612 | Plate Z-Factor: | 0.8946 |
| png ps pdf |
DBLink | Rows returned: 4 | |
31620 |
[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |
441333 |
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |
441334 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
657301 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
internal high similarity DBLink | Rows returned: 4 | |
|