| Compound Information | SONAR Target prediction | | Name: | N-Oleoyldopamine | | Unique Identifier: | LOPAC 01216 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H43NO3 | | Molecular Weight: | 374.283 g/mol | | X log p: | 10.603 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 19 | | Canonical Smiles: | CCCCCCCCC=CCCCCCCCC(=O)NCCc1ccc(O)c(O)c1 | | Class: | Neurotransmission | | Action: | Ligand | | Selectivity: | CB1 |
| Species: |
4932 |
| Condition: |
GIM3 |
| Replicates: |
4 |
| Raw OD Value: r im |
0.3971±0.102383 |
| Normalized OD Score: sc h |
0.8109±0.0312958 |
| Z-Score: |
-4.1250±0.705674 |
| p-Value: |
0.0000519816 |
| Z-Factor: |
-8.70093 |
| Fitness Defect: |
9.8646 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 14|B9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0449±0.00172 | | Plate DMSO Control (-): | 0.6325500000000001±0.12355 | | Plate Z-Factor: | -0.2139 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 443751 |
N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
| 5282106 |
(E)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 16111 | Additional Members: 9 | Rows returned: 0 | |
|