Compound Information | SONAR Target prediction | Name: | N-Oleoyldopamine | Unique Identifier: | LOPAC 01216 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H43NO3 | Molecular Weight: | 374.283 g/mol | X log p: | 10.603 (online calculus) | Lipinksi Failures | 2 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 19 | Canonical Smiles: | CCCCCCCCC=CCCCCCCCC(=O)NCCc1ccc(O)c(O)c1 | Class: | Neurotransmission | Action: | Ligand | Selectivity: | CB1 |
Species: |
4932 |
Condition: |
NOP13 |
Replicates: |
2 |
Raw OD Value: r im |
0.7003±0.00438406 |
Normalized OD Score: sc h |
0.9991±0.00260878 |
Z-Score: |
-0.0530±0.129573 |
p-Value: |
0.9271 |
Z-Factor: |
-42.1922 |
Fitness Defect: |
0.0757 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 14|B9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.046875±0.00098 | Plate DMSO Control (-): | 0.6715249999999999±0.02625 | Plate Z-Factor: | 0.8730 |
| png ps pdf |
DBLink | Rows returned: 2 | |
443751 |
N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
5282106 |
(E)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16111 | Additional Members: 9 | Rows returned: 0 | |
|