| Compound Information | SONAR Target prediction | | Name: | Quercetin dihydrate | | Unique Identifier: | LOPAC 01176 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O7 | | Molecular Weight: | 292.156 g/mol | | X log p: | 11.519 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | | Class: | Cyclic Nucleotides | | Action: | Inhibitor | | Selectivity: | PDE | | Generic_name: | 2-(3,4,5-TRIHYDROXYPHENYL)-3,5,7-TRIHYDR | | Chemical_iupac_name: | 3,5,7-TRIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-4H-CHROMEN-4-ONE | | Drug_type: | Experimental | | Drugbank_id: | EXPT02265 | | Drug_category: | Phosphatidylinositol 3-Kinase Catalytic Subu inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
GAS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7172±0.00855599 |
| Normalized OD Score: sc h |
1.0030±0.00279867 |
| Z-Score: |
0.1450±0.134115 |
| p-Value: |
0.885242 |
| Z-Factor: |
-35.346 |
| Fitness Defect: |
0.1219 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 13|D10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.40 Celcius | | Date: | 2005-11-17 YYYY-MM-DD | | Plate CH Control (+): | 0.039650000000000005±0.19027 | | Plate DMSO Control (-): | 0.70805±0.02708 | | Plate Z-Factor: | 0.8521 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 5280343 |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one |
| 5281672 |
3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| 5284452 |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one dihydrate |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 10732 | Additional Members: 22 | Rows returned: 8 | 1 2 Next >> |
|
