| Compound Information | SONAR Target prediction | | Name: | PD 98,059 | | Unique Identifier: | LOPAC 01174 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H13NO3 | | Molecular Weight: | 254.176 g/mol | | X log p: | 16.42 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | COc1cccc(c1N)C1Oc2ccccc2C(=O)C=1 | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | MEK2 |
| Species: |
4932 |
| Condition: |
SQS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6466±0.00268701 |
| Normalized OD Score: sc h |
0.9070±0.00364786 |
| Z-Score: |
-4.6406±0.8696 |
| p-Value: |
0.000028474 |
| Z-Factor: |
-0.448143 |
| Fitness Defect: |
10.4665 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 13|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-21 YYYY-MM-DD | | Plate CH Control (+): | 0.049025±0.00179 | | Plate DMSO Control (-): | 0.721975±0.02769 | | Plate Z-Factor: | 0.8852 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 4713 |
2-(2-amino-3-methoxy-phenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
|
