Compound Information | SONAR Target prediction | Name: | 5alpha-Pregnan-3alpha-ol-11,20-dione | Unique Identifier: | LOPAC 01140 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H32O3 | Molecular Weight: | 304.255 g/mol | X log p: | -0.808 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1CCC2C3CCC4CC(O)CCC4(C)C3C(=O)CC21C | Class: | GABA | Action: | Modulator | Selectivity: | GABA-A |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6006±0.0234759 |
Normalized OD Score: sc h |
0.9710±0.00442148 |
Z-Score: |
-0.7900±0.0579325 |
p-Value: |
0.429912 |
Z-Factor: |
-3.77498 |
Fitness Defect: |
0.8442 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 12|E10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.039900000000000005±0.00217 | Plate DMSO Control (-): | 0.6669±0.01835 | Plate Z-Factor: | 0.9014 |
| png ps pdf |
7002436 |
(3S,5S,8R,9R,10S,13R,14S,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7002437 |
(3S,5S,8R,9R,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7002438 |
(3S,5S,8R,9S,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056778 |
(3R,5R,8S,9R,10S,13R,14S,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056779 |
(3R,5R,8S,9R,10S,13R,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
7056780 |
(3R,5R,8S,9R,10S,13R,14R,17R)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetrad ecahydrocyclopenta[a]phenanthren-11-one |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 7027 | Additional Members: 5 | Rows returned: 0 | |
|