| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
BY4743 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6799±0.00975807 |
| Normalized OD Score: sc h |
0.9524±0.0707487 |
| Z-Score: |
-1.2597±1.88038 |
| p-Value: |
0.47692 |
| Z-Factor: |
-6.42775 |
| Fitness Defect: |
0.7404 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-19 YYYY-MM-DD | | Plate CH Control (+): | 0.0514±0.00217 | | Plate DMSO Control (-): | 0.6902250000000001±0.03299 | | Plate Z-Factor: | 0.9048 |
|  png
ps
pdf |
| 36585 |
1-(1-adamantyl)-2-hydroxy-ethanone |
| 70745 |
1-(1-hydroxycyclohexyl)ethanone |
| 86681 |
8-hydroxytetradecan-7-one |
| 91172 |
4-hydroxy-4,7,7-trimethyl-norcaran-3-one |
| 91475 |
2-hydroxy-1-[(5R,8R,9S,10S,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra
decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| 101115 |
2-hydroxy-2,6,6-trimethyl-cyclohexan-1-one |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 17389 | Additional Members: 4 | Rows returned: 3 | |
|
