| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
PAC10 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7800±0.00162635 |
| Normalized OD Score: sc h |
1.0433±0.00670219 |
| Z-Score: |
1.9694±0.279777 |
| p-Value: |
0.0533424 |
| Z-Factor: |
-1.93692 |
| Fitness Defect: |
2.931 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2005-04-15 YYYY-MM-DD | | Plate CH Control (+): | 0.045075000000000004±0.00073 | | Plate DMSO Control (-): | 0.7179500000000001±0.03738 | | Plate Z-Factor: | 0.9379 |
|  png
ps
pdf |
| 543400 |
2-hydroxycyclopentadecan-1-one |
| 543936 |
1-(3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenant
hren-17-yl)ethanone |
| 545356 |
2-hydroxycyclooctan-1-one |
| 566013 |
n/a |
| 574047 |
8a-hydroxydecalin-1-one |
| 627256 |
17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant
hren-3-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|
