Compound Information | SONAR Target prediction | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | Unique Identifier: | LOPAC 01126 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H34O3 | Molecular Weight: | 301.231 g/mol | X log p: | -0.154 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | Class: | GABA | Action: | Modulator | Selectivity: | GABA-A |
Species: |
4932 |
Condition: |
SQS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6999±0.00318198 |
Normalized OD Score: sc h |
0.9954±0.000562375 |
Z-Score: |
-0.2255±0.0234441 |
p-Value: |
0.821616 |
Z-Factor: |
-12.1245 |
Fitness Defect: |
0.1965 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 12|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-05-21 YYYY-MM-DD | Plate CH Control (+): | 0.048150000000000005±0.00169 | Plate DMSO Control (-): | 0.709625±0.03046 | Plate Z-Factor: | 0.7933 |
| png ps pdf |
273575 |
2-hydroxycyclododecan-1-one |
281911 |
5-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent a[a]phenanthren-6-one |
435225 |
2-hydroxy-1-norbornan-2-yl-ethanone |
495874 |
1-hydroxycycloheptane-1-carbaldehyde |
536976 |
1-(3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren -17-yl)ethanone |
537035 |
2-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclop enta[a]phenanthren-3-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|