| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
MRC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8475±0.0487904 |
| Normalized OD Score: sc h |
1.0145±0.0255069 |
| Z-Score: |
0.9747±1.76276 |
| p-Value: |
0.406088 |
| Z-Factor: |
-6.58096 |
| Fitness Defect: |
0.9012 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2005-12-06 YYYY-MM-DD | | Plate CH Control (+): | 0.33182500000000004±0.13802 | | Plate DMSO Control (-): | 0.8097749999999999±0.01236 | | Plate Z-Factor: | 0.9373 |
| png ps pdf |
| 257630 |
(5R,8R,9S,10S,13R,14S,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetrade cahydrocyclopenta[a]phenanthren-3-one |
| 259753 |
2-hydroxycyclodecan-1-one |
| 267196 |
2-hydroxycyclononan-1-one |
| 270840 |
2-hydroxy-1-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]p henanthren-17-yl)ethanone |
| 271910 |
2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1H-pice n-3-one |
| 273570 |
n/a |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|