| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
WHI5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6269±0.0500632 |
| Normalized OD Score: sc h |
1.0123±0.0521914 |
| Z-Score: |
0.4682±1.62289 |
| p-Value: |
0.301534 |
| Z-Factor: |
-5.47904 |
| Fitness Defect: |
1.1989 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.045875±0.00087 | | Plate DMSO Control (-): | 0.6643749999999999±0.09786 | | Plate Z-Factor: | 0.7360 |
| png ps pdf |
| 7099846 |
n/a |
| 7099847 |
n/a |
| 7099848 |
n/a |
| 7099849 |
n/a |
| 7099888 |
(5R,8S,9R,10R,13R,14S,17R)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,1 5,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| 7099889 |
(5R,8S,9S,10R,13R,14S,17R)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,1 5,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|