| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7945±0.042591 |
| Normalized OD Score: sc h |
0.9780±0.0427759 |
| Z-Score: |
-0.7518±1.67739 |
| p-Value: |
0.293728 |
| Z-Factor: |
-58.1442 |
| Fitness Defect: |
1.2251 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.80 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04828125±0.00201 | | Plate DMSO Control (-): | 0.7658250000000002±0.03188 | | Plate Z-Factor: | 0.8701 |
| png ps pdf |
| 7092965 |
(2R,4aS,6aR,6aS,6bS,8aS,12aS,14aS,14bS)-2-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-2,4a,5,6,6b,7,8,9,10 ,12,12a,13,14,14a-tetradecahydro-1H-picen-3-one |
| 7092966 |
(2R,4aR,6aR,6aS,6bS,8aS,12aS,14aR,14bS)-2-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-2,4a,5,6,6b,7,8,9,10 ,12,12a,13,14,14a-tetradecahydro-1H-picen-3-one |
| 7092967 |
(2R,4aS,6aR,6aS,6bS,8aS,12aS,14aR,14bS)-2-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-2,4a,5,6,6b,7,8,9,10 ,12,12a,13,14,14a-tetradecahydro-1H-picen-3-one |
| 7093126 |
1-[(3R,5S,8R,9R,10S,13S,14S,16S,17R)-3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16- tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| 7093158 |
1-[(3R,5S,8R,9R,10S,13S,14S,16R,17R)-3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16- tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| 7093538 |
1-[(3R,5R,8S,9S,10S,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradec ahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|