| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
tep1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7894±0.00947523 |
| Normalized OD Score: sc h |
1.0426±0.00238738 |
| Z-Score: |
1.6155±0.0718778 |
| p-Value: |
0.106654 |
| Z-Factor: |
-1.81183 |
| Fitness Defect: |
2.2382 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-07-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04295±0.00213 | | Plate DMSO Control (-): | 0.726725±0.03544 | | Plate Z-Factor: | 0.8623 |
| png ps pdf |
| 7056541 |
(3R,5S,8R,9R,10S,13S,14S)-3-acetyl-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H- cyclopenta[a]phenanthren-17-one |
| 7056542 |
(3S,5S,8S,9R,10S,13S,14S)-3-acetyl-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H- cyclopenta[a]phenanthren-17-one |
| 7056543 |
(3R,5S,8S,9R,10S,13S,14S)-3-acetyl-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H- cyclopenta[a]phenanthren-17-one |
| 7064610 |
(2S)-1-(1-adamantyl)-2-hydroxy-propan-1-one |
| 7064611 |
(2R)-1-(1-adamantyl)-2-hydroxy-propan-1-one |
| 7092964 |
(2R,4aR,6aR,6aS,6bS,8aS,12aS,14aS,14bS)-2-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-2,4a,5,6,6b,7,8,9,10 ,12,12a,13,14,14a-tetradecahydro-1H-picen-3-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|