| Compound Information | SONAR Target prediction | | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | | Unique Identifier: | LOPAC 01126 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H34O3 | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.154 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | | Class: | GABA | | Action: | Modulator | | Selectivity: | GABA-A |
| Species: |
4932 |
| Condition: |
NOP13 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7349±0.0130108 |
| Normalized OD Score: sc h |
1.0361±0.00916382 |
| Z-Score: |
1.7358±0.679974 |
| p-Value: |
0.118062 |
| Z-Factor: |
-3.57227 |
| Fitness Defect: |
2.1365 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0469±0.00117 | | Plate DMSO Control (-): | 0.698±0.08139 | | Plate Z-Factor: | 0.6415 |
| png ps pdf |
| 7002912 |
1-[(3S,5R,8S,9S,10R,13R,14R,16R,17S)-3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16- tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| 7002930 |
1-[(3S,5R,8S,9S,10R,13R,14R,16S,17S)-3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16- tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| 7003213 |
(5R,8R,9S,10R,13R,14S,16S,17S)-17-acetyl-17-hydroxy-10,13,16-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dode cahydro-1H-cyclopenta[a]phenanthren-3-one |
| 7054202 |
1-[(1R,2R,5S)-1-hydroxy-2-methyl-5-propan-2-yl-cyclohexyl]ethanone |
| 7054203 |
1-[(1R,2S,5S)-1-hydroxy-2-methyl-5-propan-2-yl-cyclohexyl]ethanone |
| 7054204 |
1-[(1R,2R,5R)-1-hydroxy-2-methyl-5-propan-2-yl-cyclohexyl]ethanone |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|