Compound Information | SONAR Target prediction | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | Unique Identifier: | LOPAC 01126 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H34O3 | Molecular Weight: | 301.231 g/mol | X log p: | -0.154 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | Class: | GABA | Action: | Modulator | Selectivity: | GABA-A |
Species: |
4932 |
Condition: |
tep1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.7894±0.00947523 |
Normalized OD Score: sc h |
1.0426±0.00238738 |
Z-Score: |
1.6155±0.0718778 |
p-Value: |
0.106654 |
Z-Factor: |
-1.81183 |
Fitness Defect: |
2.2382 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 12|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-07-07 YYYY-MM-DD | Plate CH Control (+): | 0.04295±0.00213 | Plate DMSO Control (-): | 0.726725±0.03544 | Plate Z-Factor: | 0.8623 |
| png ps pdf |
5115269 |
1-(1-adamantyl)-1-hydroxy-propan-2-one |
5318299 |
n/a |
6428543 |
3-hydroxyoctan-2-one |
6451493 |
(5S,8R,9S,10S,13R,14S,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetrade cahydrocyclopenta[a]phenanthren-3-one |
6542889 |
1-[(3S,5S,8S,9R,10S,13S,14S,16R,17R)-3,17-dihydroxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16- tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
6543689 |
n/a |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|