Compound Information | SONAR Target prediction | Name: | 3-alpha,21-Dihydroxy-5-alpha-pregnan-20-one | Unique Identifier: | LOPAC 01126 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H34O3 | Molecular Weight: | 301.231 g/mol | X log p: | -0.154 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CCC(O)CC1CCC1C3CCC(C(=O)CO)C3(C)CCC12 | Class: | GABA | Action: | Modulator | Selectivity: | GABA-A |
Species: |
4932 |
Condition: |
ESC2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5726±0.0316077 |
Normalized OD Score: sc h |
1.0230±0.0148328 |
Z-Score: |
0.6994±0.415273 |
p-Value: |
0.50282 |
Z-Factor: |
-4.09687 |
Fitness Defect: |
0.6875 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 12|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.30 Celcius | Date: | 2005-11-25 YYYY-MM-DD | Plate CH Control (+): | 0.03955±0.00174 | Plate DMSO Control (-): | 0.5625249999999999±0.02532 | Plate Z-Factor: | 0.9222 |
| png ps pdf |
4231760 |
2-hydroxy-2-methyl-4-tert-butyl-cyclohexan-1-one |
4286359 |
3-acetyl-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-1 7-one |
4308580 |
1-(1-adamantyl)-2-hydroxy-propan-1-one |
4577356 |
2-hydroxycyclohexadecan-1-one |
4614436 |
1-(17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17- yl)ethanone |
4662618 |
1-cyclohexyl-1-hydroxy-propan-2-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 17389 | Additional Members: 4 | Rows returned: 2 | |
|