| Compound Information | SONAR Target prediction |
| Name: | Parthenolide |
| Unique Identifier: | LOPAC 01123 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H20O3 |
| Molecular Weight: | 230.175 g/mol |
| X log p: | 1.683 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 38.83 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(OC(=O)C2=C)C2OC2(C)CCC=1 |
| Class: | Serotonin |
| Action: | Inhibitor |
| Found: 21 nonactive | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | MRC1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8003±0.0203647 |
| Normalized OD Score: sc h | 0.9597±0.00431936 |
| Z-Score: | -2.9267±0.037006 |
| p-Value: | 0.00343652 |
| Z-Factor: | -0.515332 |
| Fitness Defect: | 5.6733 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 16 | 1 2 3 Next >> |
| 4692 |
| 108068 |
| 927704 |
| 5320420 |
| 5353864 |
| 5420804 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01503640 | 1.0000 |
| active | Cluster 2298 | Additional Members: 5 | Rows returned: 2 |
| SPE01503640 | 0 |
| LAT003F02 | 0 |
Service provided by the
Mike Tyers Laboratory