| Compound Information | SONAR Target prediction | | Name: | Piceatannol | | Unique Identifier: | LOPAC 01122 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H12O4 | | Molecular Weight: | 232.147 g/mol | | X log p: | 17.259 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1cc(O)cc(C=Cc2ccc(O)c(O)c2)c1 | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | Syk / Lck |
| Species: |
4932 |
| Condition: |
MRC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8270±0.0218496 |
| Normalized OD Score: sc h |
0.9918±0.00315981 |
| Z-Score: |
-0.5853±0.174386 |
| p-Value: |
0.56135 |
| Z-Factor: |
-7.3684 |
| Fitness Defect: |
0.5774 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 12|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2005-12-06 YYYY-MM-DD | | Plate CH Control (+): | 0.33182500000000004±0.13802 | | Plate DMSO Control (-): | 0.8097749999999999±0.01236 | | Plate Z-Factor: | 0.9373 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 4813 |
4-[2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| 667639 |
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| 6603962 |
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1910 | Additional Members: 8 | Rows returned: 4 | |
|