Compound Information | SONAR Target prediction | Name: | Piceatannol | Unique Identifier: | LOPAC 01122 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H12O4 | Molecular Weight: | 232.147 g/mol | X log p: | 17.259 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | Oc1cc(O)cc(C=Cc2ccc(O)c(O)c2)c1 | Class: | Phosphorylation | Action: | Inhibitor | Selectivity: | Syk / Lck |
Species: |
4932 |
Condition: |
LGE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5225±0.0334462 |
Normalized OD Score: sc h |
0.9776±0.0102115 |
Z-Score: |
-0.7739±0.372981 |
p-Value: |
0.454702 |
Z-Factor: |
-3.58437 |
Fitness Defect: |
0.7881 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 12|D6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2005-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.0392±0.00064 | Plate DMSO Control (-): | 0.5160750000000001±0.01307 | Plate Z-Factor: | 0.9173 |
| png ps pdf |
DBLink | Rows returned: 3 | |
4813 |
4-[2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
667639 |
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
6603962 |
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1910 | Additional Members: 8 | Rows returned: 4 | |
|