| Compound Information | SONAR Target prediction |
| Name: | Nordihydroguaiaretic acid from Larrea divaricata (creosote bush) |
| Unique Identifier: | LOPAC 01089 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18H22O4 |
| Molecular Weight: | 280.19 g/mol |
| X log p: | 14.138 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 0 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(O)c(O)c1 |
| Class: | Leukotriene |
| Action: | Inhibitor |
| Selectivity: | Lipoxygenase |
| Generic_name: | Masoprocol |
| Chemical_iupac_name: | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450325 |
| Kegg_compound_id: | C10719 |
| Drugbank_id: | APRD01084 |
| Melting_point: | 185.5 oC |
| Logp: | 4.018 |
| Cas_registry_number: | 500-38-9 |
| Drug_category: | Antineoplastics, topical; Antioxidants; Cyclooxygenase Inhibitors; Keratolytic Agents; Lipoxygenase Inhibitors; ATC:L01XX10 |
| Indication: | Used for the treatment of actinic keratoses (precancerous skin growths that can become malignant if left untreated). |
| Pharmacology: | Masoprocol is a novel antineoplastic agent. It is not known exactly how masoprocol works. Laboratory experiments have shown that masoprocol prevents cells similar to the ones found in actinic keratoses from multiplying. Masoprocol was withdrawn from the U.S. market in June 1996. |
| Mechanism_of_action: | Although the exact mechanism of action is not known, studies have shown that masoprocol is a potent 5-lipoxygenase inhibitor and has antiproliferative activity against keratinocytes in tissue culture, but the relationship between this activity and its effectiveness in actinic keratoses is unknown. Masoprocol also inhibits prostaglandins but the significance of this action is not yet known. |
| Organisms_affected: | Humans and other mammals |
| Found: 15 nonactive | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | BY4743 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8387±0.183211 |
| Normalized OD Score: sc h | 1.0224±0.0274535 |
| Z-Score: | 0.6319±0.780619 |
| p-Value: | 0.586404 |
| Z-Factor: | -5.44016 |
| Fitness Defect: | 0.5337 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 5 |
| 4534 | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| 71398 | 4-[(2R,3S)-4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| 688035 | 4-[(2S,3S)-4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| 688036 | 4-[(2R,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| 5317328 | 4-[(2R,3S)-4-(4-hydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01502206 | 1.0000 |
| active | Cluster 12980 | Additional Members: 10 | Rows returned: 1 |
| SPE01502206 | 0.55 |
Service provided by the
Mike Tyers Laboratory