| Compound Information | SONAR Target prediction | | Name: | Mitoxantrone | | Unique Identifier: | LOPAC 01057 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22Cl2H30N4O6 | | Molecular Weight: | 487.164 g/mol | | X log p: | 6.694 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 12 | | Canonical Smiles: | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2c(=O)c3c(O)ccc(O)c3c(=O)c12 | | Class: | DNA Metabolism | | Action: | Inhibitor |
| Species: |
4932 |
| Condition: |
CIN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8335±0.000282843 |
| Normalized OD Score: sc h |
1.0376±0.000816834 |
| Z-Score: |
2.8662±0.344583 |
| p-Value: |
0.00530006 |
| Z-Factor: |
-0.261883 |
| Fitness Defect: |
5.24 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2005-12-07 YYYY-MM-DD | | Plate CH Control (+): | 0.038650000000000004±0.00333 | | Plate DMSO Control (-): | 0.79475±0.01359 | | Plate Z-Factor: | 0.9164 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 4212 |
5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 14085 | Additional Members: 3 | Rows returned: 2 | |
|
