| Compound Information | SONAR Target prediction | | Name: | Mitoxantrone | | Unique Identifier: | LOPAC 01057 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22Cl2H30N4O6 | | Molecular Weight: | 487.164 g/mol | | X log p: | 6.694 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 12 | | Canonical Smiles: | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2c(=O)c3c(O)ccc(O)c3c(=O)c12 | | Class: | DNA Metabolism | | Action: | Inhibitor |
| Species: |
4932 |
| Condition: |
SAP30 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8245±0.0142128 |
| Normalized OD Score: sc h |
1.0202±0.00202991 |
| Z-Score: |
1.7474±0.286687 |
| p-Value: |
0.0867846 |
| Z-Factor: |
-1.41759 |
| Fitness Defect: |
2.4443 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2005-11-18 YYYY-MM-DD | | Plate CH Control (+): | 0.03945±0.00129 | | Plate DMSO Control (-): | 0.79005±0.01014 | | Plate Z-Factor: | 0.9504 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 4212 |
5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 14085 | Additional Members: 3 | Rows returned: 2 | |
|