| Compound Information | SONAR Target prediction |  | Name: | Mitoxantrone |  | Unique Identifier: | LOPAC 01057  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C22Cl2H30N4O6 |  | Molecular Weight: | 487.164 g/mol |  | X log p: | 6.694  (online calculus) |  | Lipinksi Failures | 2 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 10 |  | Rotatable Bond Count: | 12 |  | Canonical Smiles: | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2c(=O)c3c(O)ccc(O)c3c(=O)c12 |  | Class: | DNA Metabolism |  | Action: | Inhibitor |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		PAC10 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7801±0.000353553 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0687±0.00618238 | 
	 
	
		| Z-Score: | 
		3.1237±0.241493 | 
	 
	
		| p-Value: | 
		0.00206678 | 
	 
	
		| Z-Factor: | 
		-0.107321 | 
	 
	
		| Fitness Defect: | 
		6.1818 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 10|F10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.60 Celcius |  | Date: | 2005-04-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.04575±0.00087 |  | Plate DMSO Control (-): | 0.705125±0.01540 |  | Plate Z-Factor: | 0.9239 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 4212 | 
		5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 14085 | Additional Members: 3 | Rows returned: 2 |  |   
 
 |