Compound Information | SONAR Target prediction | Name: | Mitoxantrone | Unique Identifier: | LOPAC 01057 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22Cl2H30N4O6 | Molecular Weight: | 487.164 g/mol | X log p: | 6.694 (online calculus) | Lipinksi Failures | 2 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 12 | Canonical Smiles: | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2c(=O)c3c(O)ccc(O)c3c(=O)c12 | Class: | DNA Metabolism | Action: | Inhibitor |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7307±0.00572756 |
Normalized OD Score: sc h |
0.9927±0.0170375 |
Z-Score: |
-0.3996±1.00342 |
p-Value: |
0.511998 |
Z-Factor: |
-9.52372 |
Fitness Defect: |
0.6694 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|F10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-30 YYYY-MM-DD | Plate CH Control (+): | 0.038900000000000004±0.00089 | Plate DMSO Control (-): | 0.7255±0.01549 | Plate Z-Factor: | 0.9380 |
| png ps pdf |
DBLink | Rows returned: 1 | |
4212 |
5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14085 | Additional Members: 3 | Rows returned: 2 | |
|