| Compound Information | SONAR Target prediction | | Name: | Morin | | Unique Identifier: | LOPAC 01047 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O7 | | Molecular Weight: | 292.156 g/mol | | X log p: | 11.09 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(c(O)c1)C1Oc2cc(O)cc(O)c2C(=O)C=1O | | Class: | Cell Stress | | Action: | Inhibitor | | Selectivity: | Antioxidant |
| Species: |
4932 |
| Condition: |
SAP30 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8172±0.0123037 |
| Normalized OD Score: sc h |
1.0050±0.00141592 |
| Z-Score: |
0.4370±0.149927 |
| p-Value: |
0.663862 |
| Z-Factor: |
-11.9841 |
| Fitness Defect: |
0.4097 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2005-11-18 YYYY-MM-DD | | Plate CH Control (+): | 0.03945±0.00129 | | Plate DMSO Control (-): | 0.79005±0.01014 | | Plate Z-Factor: | 0.9504 |
|  png
ps
pdf |
| 3365422 |
calcium [2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxoniumylidene-chromen-5-yl]oxidanium |
| 5281670 |
2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one |
| 5478571 |
3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxo-chromen-5-olate; titanium(+4) cation |
| 5841189 |
[5-oxonio-2-(3,5,7-trihydroxy-4-oxo-chromen-2-yl)phenyl]oxidanium; titanium |
| 6711742 |
2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one; titanium |
| 11980426 |
3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxoniumylidene-chromen-5-olate; titanium |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 10732 | Additional Members: 22 | Rows returned: 8 | 1 2 Next >> |
|
