| Compound Information | SONAR Target prediction | | Name: | Morin | | Unique Identifier: | LOPAC 01047 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O7 | | Molecular Weight: | 292.156 g/mol | | X log p: | 11.09 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(c(O)c1)C1Oc2cc(O)cc(O)c2C(=O)C=1O | | Class: | Cell Stress | | Action: | Inhibitor | | Selectivity: | Antioxidant |
| Species: |
4932 |
| Condition: |
WHI5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6283±0.0203647 |
| Normalized OD Score: sc h |
1.0093±0.0162148 |
| Z-Score: |
0.2529±0.456289 |
| p-Value: |
0.75466 |
| Z-Factor: |
-4.28661 |
| Fitness Defect: |
0.2815 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.045975±0.00101 | | Plate DMSO Control (-): | 0.66755±0.06920 | | Plate Z-Factor: | 0.5902 |
| png ps pdf |
| 15976528 |
calcium 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-chromen-3-olate |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 10732 | Additional Members: 22 | Rows returned: 8 | 1 2 Next >> |
|