Compound Information | SONAR Target prediction | Name: | Morin | Unique Identifier: | LOPAC 01047 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O7 | Molecular Weight: | 292.156 g/mol | X log p: | 11.09 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc(c(O)c1)C1Oc2cc(O)cc(O)c2C(=O)C=1O | Class: | Cell Stress | Action: | Inhibitor | Selectivity: | Antioxidant |
Species: |
4932 |
Condition: |
DEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6026±0.0157685 |
Normalized OD Score: sc h |
1.0014±0.00228331 |
Z-Score: |
0.0532±0.0913032 |
p-Value: |
0.948596 |
Z-Factor: |
-13.5416 |
Fitness Defect: |
0.0528 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|F7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-16 YYYY-MM-DD | Plate CH Control (+): | 0.0392±0.00130 | Plate DMSO Control (-): | 0.590575±0.00799 | Plate Z-Factor: | 0.9457 |
| png ps pdf |
3365422 |
calcium [2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxoniumylidene-chromen-5-yl]oxidanium |
5281670 |
2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one |
5478571 |
3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxo-chromen-5-olate; titanium(+4) cation |
5841189 |
[5-oxonio-2-(3,5,7-trihydroxy-4-oxo-chromen-2-yl)phenyl]oxidanium; titanium |
6711742 |
2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one; titanium |
11980426 |
3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxoniumylidene-chromen-5-olate; titanium |
internal high similarity DBLink | Rows returned: 9 | << Back 1 2 |
active | Cluster 10732 | Additional Members: 22 | Rows returned: 8 | << Back 1 2 |
|