Compound Information | SONAR Target prediction | Name: | MRS 2179 | Unique Identifier: | LOPAC 01046 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11H23N7O9P2 | Molecular Weight: | 436.107 g/mol | X log p: | 0.47 (online calculus) | Lipinksi Failures | 1 | TPSA | 167.89 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 14 | Rotatable Bond Count: | 7 | Canonical Smiles: | [NH4+].[NH4+].[O-]P(O)(=O)OCC1OC(CC1OP([O-])(O)=O)n1cnc2c(NC)ncnc12 | Class: | P2 Receptor | Action: | Antagonist | Selectivity: | P2Y1 |
Species: |
4932 |
Condition: |
HOC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5563±0.00898026 |
Normalized OD Score: sc h |
1.0111±0.0230154 |
Z-Score: |
0.5574±1.10646 |
p-Value: |
0.50116 |
Z-Factor: |
-11.296 |
Fitness Defect: |
0.6908 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2005-11-24 YYYY-MM-DD | Plate CH Control (+): | 0.03885±0.00128 | Plate DMSO Control (-): | 0.54495±0.00984 | Plate Z-Factor: | 0.9366 |
| png ps pdf |
6604940 |
azane; [(2S,3S,5R)-5-(6-methylaminopurin-9-yl)-3-phosphonooxy-oxolan-2-yl]methoxyphosphonic acid |
6604941 |
[(2S,3S,5R)-5-(6-methylaminopurin-9-yl)-3-phosphonooxy-oxolan-2-yl]methoxyphosphonic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 | |
|