Compound Information | SONAR Target prediction | Name: | MRS 2179 | Unique Identifier: | LOPAC 01046 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11H23N7O9P2 | Molecular Weight: | 436.107 g/mol | X log p: | 0.47 (online calculus) | Lipinksi Failures | 1 | TPSA | 167.89 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 14 | Rotatable Bond Count: | 7 | Canonical Smiles: | [NH4+].[NH4+].[O-]P(O)(=O)OCC1OC(CC1OP([O-])(O)=O)n1cnc2c(NC)ncnc12 | Class: | P2 Receptor | Action: | Antagonist | Selectivity: | P2Y1 |
Species: |
4932 |
Condition: |
BY4743 |
Replicates: |
2 |
Raw OD Value: r im |
0.7786±0.149836 |
Normalized OD Score: sc h |
0.9888±0.0179234 |
Z-Score: |
-0.2962±0.477414 |
p-Value: |
0.746606 |
Z-Factor: |
-29.4588 |
Fitness Defect: |
0.2922 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-08-19 YYYY-MM-DD | Plate CH Control (+): | 0.05020000000000001±0.00232 | Plate DMSO Control (-): | 0.80245±0.03140 | Plate Z-Factor: | 0.8935 |
| png ps pdf |
6604940 |
azane; [(2S,3S,5R)-5-(6-methylaminopurin-9-yl)-3-phosphonooxy-oxolan-2-yl]methoxyphosphonic acid |
6604941 |
[(2S,3S,5R)-5-(6-methylaminopurin-9-yl)-3-phosphonooxy-oxolan-2-yl]methoxyphosphonic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 | |
|