Compound Information | SONAR Target prediction | Name: | Mizoribine | Unique Identifier: | LOPAC 01041 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C9H13N3O6 | Molecular Weight: | 246.113 g/mol | X log p: | 2.276 (online calculus) | Lipinksi Failures | 0 | TPSA | 41.9 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 3 | Canonical Smiles: | NC(=O)c1ncn(C2OC(CO)C(O)C2O)c1O | Class: | DNA Metabolism | Action: | Inhibitor | Selectivity: | IMP dehydrogenase |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6727±0.0013435 |
Normalized OD Score: sc h |
0.9998±0.00904207 |
Z-Score: |
-0.0282±0.510361 |
p-Value: |
0.718296 |
Z-Factor: |
-4998.61 |
Fitness Defect: |
0.3309 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|C6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.80 Celcius | Date: | 2005-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.047174999999999995±0.00052 | Plate DMSO Control (-): | 0.652675±0.01519 | Plate Z-Factor: | 0.9153 |
| png ps pdf |
DBLink | Rows returned: 3 | |
4213 |
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
104762 |
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
6603923 |
1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
internal high similarity DBLink | Rows returned: 1 | |
|