| Compound Information | SONAR Target prediction |
| Name: | Mevastatin |
| Unique Identifier: | LOPAC 01035 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H34O5 |
| Molecular Weight: | 360.275 g/mol |
| X log p: | 5.569 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 7 |
| Canonical Smiles: | CCC(C)C(=O)OC1CCC=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C12 |
| Class: | Antibiotic |
| Action: | Inhibitor |
| Selectivity: | Ras, Rho |
| Generic_name: | Simvastatin |
| Chemical_iupac_name: | [8-[2-(4-hydroxy-6-oxo-tetrahydropyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahyd ronaphthalen-1-yl]2,2-dimethylbutanoate |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451363 |
| Kegg_compound_id: | D00434 |
| Drugbank_id: | APRD00104 |
| Melting_point: | 135-138oC |
| H2o_solubility: | 0.76 mg/L |
| Logp: | 4.937 |
| Cas_registry_number: | 79902-63-9 |
| Drug_category: | Antilipemic Agents; Anticholesteremic Agents; HMG-CoA Reductase Inhibitors; ATC:C10AA01 |
| Indication: | For the treatment of hypercholesterolemia. |
| Pharmacology: | Simvastatin, the methylated form of lovastatin, is an oral antilipemic agent which inhibits HMG-CoA reductase. simvastatin is used in the treatment of primary hypercholesterolemia and is effective in reducing total and LDL-cholesterol as well as plasma triglycerides and apolipoprotein B. |
| Mechanism_of_action: | The 6-membered lactone ring of simvastatin is hydrolyzed in vivo to generate mevinolinic acid, an active metabolite structurally similar to HMG-CoA (hydroxymethylglutaryl CoA). Once hydrolyzed, simvastatin competes with HMG-CoA for HMG-CoA reductase, a hepatic microsomal enzyme. Interference with the activity of this enzyme reduces the quantity of mevalonic acid, a precursor of cholesterol. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 21 22 23 24 |
| Species: | 4932 |
| Condition: | WHI5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6319±0.00898026 |
| Normalized OD Score: sc h | 0.9989±0.0112851 |
| Z-Score: | -0.0115±0.337349 |
| p-Value: | 0.811474 |
| Z-Factor: | -4.98445 |
| Fitness Defect: | 0.2089 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 37 | << Back 1 2 3 4 5 6 7 Next >> |
| 3012115 | [(1S,3R,7R,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] (2S)-2-methylbutanoate; (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-do decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 3727647 | [8-[2-(4-hydroxy-6-oxo-oxan-2-yl)ethyl]-3,7,8a-trimethyl-2,3,7,8-tetrahydro-1H-naphthalen-1-yl] 2-methylbutanoate |
| 4677798 | [8-[2-(4-hydroxy-6-oxo-oxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| 5702286 | [(1S,7R,8aR)-8-[2-[(4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| 6419910 | [(1S,3R,7R,8S,8aR)-8-[2-[(4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphth alen-1-yl] 2,2-dimethylbutanoate |
| 6420024 | [(1S,3R,7R,8S,8aR)-8-[2-[(4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphth alen-1-yl] (2S)-2-methylbutanoate |
| internal high similarity DBLink | Rows returned: 3 |
| SPE01503977 | 1.0000 |
| SPE01504236 | 1.0000 |
| SPE01601000 | 1.0000 |
| active | Cluster 2780 | Additional Members: 9 | Rows returned: 6 |
| SPE01505803 | 0.452380952380952 |
| SPE01601000 | 0.276315789473684 |
| Prest171 | 0.211267605633803 |
| SPE01504236 | 0.211267605633803 |
| LAT006B08 | 0 |
| SPE01503977 | 0 |
Service provided by the
Mike Tyers Laboratory