Compound Information | SONAR Target prediction | Name: | Metaproterenol hemisulfate | Unique Identifier: | LOPAC 01034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22H36N2O10S | Molecular Weight: | 484.309 g/mol | X log p: | 5.855 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)NCC(O)c1cc(O)cc(O)c1.CC(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O | Class: | Adrenoceptor | Action: | Agonist | Selectivity: | beta2 |
Species: |
4932 |
Condition: |
WHI3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7108±0.0188798 |
Normalized OD Score: sc h |
1.0065±0.0099125 |
Z-Score: |
0.3059±0.454636 |
p-Value: |
0.758994 |
Z-Factor: |
-9.61155 |
Fitness Defect: |
0.2758 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 10|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-20 YYYY-MM-DD | Plate CH Control (+): | 0.045±0.02353 | Plate DMSO Control (-): | 0.6721±0.02557 | Plate Z-Factor: | 0.8867 |
| png ps pdf |
DBLink | Rows returned: 4 | |
31620 |
[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |
441333 |
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |
441334 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
657301 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
internal high similarity DBLink | Rows returned: 4 | |
|