| Compound Information | SONAR Target prediction | | Name: | Metaproterenol hemisulfate | | Unique Identifier: | LOPAC 01034 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C22H36N2O10S | | Molecular Weight: | 484.309 g/mol | | X log p: | 5.855 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)NCC(O)c1cc(O)cc(O)c1.CC(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O | | Class: | Adrenoceptor | | Action: | Agonist | | Selectivity: | beta2 |
| Species: |
4932 |
| Condition: |
tep1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8045±0.0192333 |
| Normalized OD Score: sc h |
1.0308±0.000795155 |
| Z-Score: |
1.1699±0.0437104 |
| p-Value: |
0.242266 |
| Z-Factor: |
-2.32632 |
| Fitness Defect: |
1.4177 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-07-07 YYYY-MM-DD | | Plate CH Control (+): | 0.044125±0.00207 | | Plate DMSO Control (-): | 0.719775±0.02778 | | Plate Z-Factor: | 0.8687 |
| png ps pdf |
| DBLink | Rows returned: 4 | |
| 31620 |
[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |
| 441333 |
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |
| 441334 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
| 657301 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|