| Compound Information | SONAR Target prediction | | Name: | Luteolin | | Unique Identifier: | LOPAC 01016 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O6 | | Molecular Weight: | 276.157 g/mol | | X log p: | 13.108 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccc(O)c(O)c1 | | Class: | Cell Stress | | Action: | Inhibitor | | Selectivity: | Antioxidant |
| Species: |
4932 |
| Condition: |
WHI3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6852±0.00940452 |
| Normalized OD Score: sc h |
1.0151±0.00746728 |
| Z-Score: |
0.6265±0.447375 |
| p-Value: |
0.551088 |
| Z-Factor: |
-7.26278 |
| Fitness Defect: |
0.5959 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 9|B11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.044649999999999995±0.00096 | | Plate DMSO Control (-): | 0.66655±0.02487 | | Plate Z-Factor: | 0.8756 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
| 5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 22 | 1 2 3 4 Next >> |
|