Compound Information | SONAR Target prediction | Name: | Luteolin | Unique Identifier: | LOPAC 01016 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O6 | Molecular Weight: | 276.157 g/mol | X log p: | 13.108 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccc(O)c(O)c1 | Class: | Cell Stress | Action: | Inhibitor | Selectivity: | Antioxidant |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5890±0.0292742 |
Normalized OD Score: sc h |
0.8708±0.0128781 |
Z-Score: |
-3.5261±0.0713111 |
p-Value: |
0.000428852 |
Z-Factor: |
0.352562 |
Fitness Defect: |
7.7544 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 9|B11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.20 Celcius | Date: | 2005-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.038349999999999995±0.00127 | Plate DMSO Control (-): | 0.718475±0.01037 | Plate Z-Factor: | 0.9586 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 22 | 1 2 3 4 Next >> |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|