| Compound Information | SONAR Target prediction | | Name: | Luteolin | | Unique Identifier: | LOPAC 01016 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O6 | | Molecular Weight: | 276.157 g/mol | | X log p: | 13.108 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccc(O)c(O)c1 | | Class: | Cell Stress | | Action: | Inhibitor | | Selectivity: | Antioxidant |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7657±0.0582858 |
| Normalized OD Score: sc h |
1.0082±0.014137 |
| Z-Score: |
0.2632±0.500578 |
| p-Value: |
0.730242 |
| Z-Factor: |
-8.67364 |
| Fitness Defect: |
0.3144 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 9|B11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04704375000000001±0.00145 | | Plate DMSO Control (-): | 0.7456624999999997±0.03931 | | Plate Z-Factor: | 0.8748 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
| 5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|