Compound Information | SONAR Target prediction | Name: | Idarubicin | Unique Identifier: | LOPAC 00975 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H27NO9 | Molecular Weight: | 471.287 g/mol | X log p: | 4.988 (online calculus) | Lipinksi Failures | 0 | TPSA | 69.67 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1OC(CC(N)C1O)OC1CC(O)(Cc2c(O)c3c(=O)c4ccccc4c(=O)c3c(O)c12)C(C)=O | Class: | DNA Metabolism | Action: | Inhibitor |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3007±0.354685 |
Normalized OD Score: sc h |
0.4619±0.547835 |
Z-Score: |
-22.5678±22.5797 |
p-Value: |
0.0000000000203492 |
Z-Factor: |
-2.13234 |
Fitness Defect: |
24.618 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|D11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.90 Celcius | Date: | 2005-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.038925±0.00176 | Plate DMSO Control (-): | 0.655825±0.00877 | Plate Z-Factor: | 0.9516 |
| png ps pdf |
DBLink | Rows returned: 1 | |
42890 |
(7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyl-oxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydr o-7H-tetracene-5,12-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5481 | Additional Members: 8 | Rows returned: 5 | |
|