Compound Information | SONAR Target prediction | Name: | Idarubicin | Unique Identifier: | LOPAC 00975 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H27NO9 | Molecular Weight: | 471.287 g/mol | X log p: | 4.988 (online calculus) | Lipinksi Failures | 0 | TPSA | 69.67 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1OC(CC(N)C1O)OC1CC(O)(Cc2c(O)c3c(=O)c4ccccc4c(=O)c3c(O)c12)C(C)=O | Class: | DNA Metabolism | Action: | Inhibitor |
Species: |
4932 |
Condition: |
NOP13 |
Replicates: |
2 |
Raw OD Value: r im |
0.1216±0.0125865 |
Normalized OD Score: sc h |
0.1782±0.0189502 |
Z-Score: |
-38.8721±6.52441 |
p-Value: |
0 |
Z-Factor: |
0.521289 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|D11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.047725000000000004±0.00106 | Plate DMSO Control (-): | 0.6630499999999999±0.06937 | Plate Z-Factor: | 0.8144 |
| png ps pdf |
DBLink | Rows returned: 1 | |
42890 |
(7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyl-oxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydr o-7H-tetracene-5,12-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5481 | Additional Members: 8 | Rows returned: 5 | |
|